ChemNet > CAS > 38690-76-5 4-Cyanophenyl-4-heptylbenzoat
38690-76-5 4-Cyanophenyl-4-heptylbenzoat
| Produkt-Name |
4-Cyanophenyl-4-heptylbenzoat |
| Synonyme |
4-n-Heptylbenzoesäure-4-Cyanophenylester |
| Englischer Name |
4-Cyanophenyl 4-heptylbenzoate; 4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
| Molekulare Formel |
C21H23NO2 |
| Molecular Weight |
321.4128 |
| InChI |
InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
| CAS Registry Number |
38690-76-5 |
| EINECS |
254-084-0 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Schmelzpunkt |
43-45℃ |
| Siedepunkt |
476.4°C at 760 mmHg |
| Brechungsindex |
1.56 |
| Flammpunkt |
238.3°C |
| Dampfdruck |
3.07E-09mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|